CAS 1306739-90-1 is the registry number for 2-[(3,4-Dimethylphenyl)amino]-5,6-dimethylpyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,4-dimethylanilino)-4,5-dimethyl-1H-pyrimidin-6-one (CAS 1306739-90-1) is a chemical compound with the molecular formula C14H17N3O and a molecular weight of 243.30 g/mol. IUPAC name: 2-(3,4-dimethylanilino)-4,5-dimethyl-1H-pyrimidin-6-one. InChIKey: XLZOAIQEJKGKCB-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-(3,4-dimethylanilino)-4,5-dimethyl-1H-pyrimidin-6-one |
| InChIKey | XLZOAIQEJKGKCB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC(=C(C(=O)N2)C)C)C |
Computed by PubChem (NCBI)