CAS 13069-04-0 appears in our catalog under these names: Vonoprazan Impurity 68, pyridine-3,5-disulfonic acid, TAK438 Impurity 94. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Pyridine-3,5-disulfonic acid (CAS 13069-04-0) is a chemical compound with the molecular formula C5H5NO6S2 and a molecular weight of 239.2 g/mol. IUPAC name: pyridine-3,5-disulfonic acid. InChIKey: QRYROSZXZPINDI-UHFFFAOYSA-N.
| Molecular formula | C5H5NO6S2 |
|---|---|
| Molecular weight | 239.2 g/mol |
| IUPAC name | pyridine-3,5-disulfonic acid |
| InChIKey | QRYROSZXZPINDI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)