CAS 130714-47-5 appears in our catalog under these names: SDZ-WAG994, 98%, SDZ WAG 994, SDZ WAG 994/ 99.9%, SDZ WAG 994, SDZ-WAG994, 98%, 98%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 50mg, 10mg, 1mg, 5mg, 25mg, 100mg, 1 mg.
(2R,3R,4R,5R)-5-[6-(cyclohexylamino)purin-9-yl]-2-(hydroxymethyl)-4-methoxyoxolan-3-ol (CAS 130714-47-5) is a chemical compound with the molecular formula C17H25N5O4 and a molecular weight of 363.4 g/mol. IUPAC name: (2R,3R,4R,5R)-5-[6-(cyclohexylamino)purin-9-yl]-2-(hydroxymethyl)-4-methoxyoxolan-3-ol. InChIKey: JAKAFSGZUXCHLF-LSCFUAHRSA-N.
| Molecular formula | C17H25N5O4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-[6-(cyclohexylamino)purin-9-yl]-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
| InChIKey | JAKAFSGZUXCHLF-LSCFUAHRSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)NC4CCCCC4)CO)O |
Computed by PubChem (NCBI)