CAS 13072-69-0 appears in our catalog under these names: N-(1-Adamantyl)urea, 95%, N-(1-Adamantyl)-urea. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg.
1-adamantylurea (CAS 13072-69-0) is a chemical compound with the molecular formula C11H18N2O and a molecular weight of 194.27 g/mol. IUPAC name: 1-adamantylurea. InChIKey: QYYHPAUOLCHORH-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1-adamantylurea |
| InChIKey | QYYHPAUOLCHORH-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)N |
Computed by PubChem (NCBI)