CAS 130721-86-7 is the registry number for 3',5'-Bis(trifluoromethyl)-2,2,2-trimethylacetanilide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3,5-bis(trifluoromethyl)phenyl]-2,2-dimethylpropanamide (CAS 130721-86-7) is a chemical compound with the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]-2,2-dimethylpropanamide. InChIKey: XLRGMSDRJHFBNO-UHFFFAOYSA-N.
| Molecular formula | C13H13F6NO |
|---|---|
| Molecular weight | 313.24 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | XLRGMSDRJHFBNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)