CAS 1307231-10-2 appears in our catalog under these names: 4-Bromo-2-{[(tert-butyldimethylsilyl)oxy]methyl}pyridine, 98%, 4-Bromo-2-(((tert-butyldimethylsilyl)oxy)methyl)pyridine 98%, 4-Bromo-2-{[(tert-butyldimethylsilyl)oxy]methyl}pyridine, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
(4-bromo-2-pyridinyl)methoxy-tert-butyl-dimethylsilane (CAS 1307231-10-2) is a chemical compound with the molecular formula C12H20BrNOSi and a molecular weight of 302.28 g/mol. IUPAC name: (4-bromo-2-pyridinyl)methoxy-tert-butyl-dimethylsilane. InChIKey: AGAZAXKMRBMPGQ-UHFFFAOYSA-N.
| Molecular formula | C12H20BrNOSi |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | (4-bromo-2-pyridinyl)methoxy-tert-butyl-dimethylsilane |
| InChIKey | AGAZAXKMRBMPGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=NC=CC(=C1)Br |
Computed by PubChem (NCBI)