CAS 1307316-16-0 is the registry number for rac-(3R,4S)-1-Benzyl-4-(2-fluorophenyl)pyrrolidin-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S,4R)-1-benzyl-4-(2-fluorophenyl)pyrrolidin-3-amine (CAS 1307316-16-0) is a chemical compound with the molecular formula C17H19FN2 and a molecular weight of 270.34 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-(2-fluorophenyl)pyrrolidin-3-amine. InChIKey: VETUDDLKHANBAF-DOTOQJQBSA-N.
| Molecular formula | C17H19FN2 |
|---|---|
| Molecular weight | 270.34 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-(2-fluorophenyl)pyrrolidin-3-amine |
| InChIKey | VETUDDLKHANBAF-DOTOQJQBSA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)N)C3=CC=CC=C3F |
Computed by PubChem (NCBI)