CAS 1307397-26-7 is the registry number for 1-(4-Bromophenyl)-N-((1-methyl-1H-pyrazol-4-yl)methyl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-N-[(1-methylpyrazol-4-yl)methyl]ethanamine (CAS 1307397-26-7) is a chemical compound with the molecular formula C13H16BrN3 and a molecular weight of 294.19 g/mol. IUPAC name: 1-(4-bromophenyl)-N-[(1-methylpyrazol-4-yl)methyl]ethanamine. InChIKey: NBYKRQFTMDHKHR-UHFFFAOYSA-N.
| Molecular formula | C13H16BrN3 |
|---|---|
| Molecular weight | 294.19 g/mol |
| IUPAC name | 1-(4-bromophenyl)-N-[(1-methylpyrazol-4-yl)methyl]ethanamine |
| InChIKey | NBYKRQFTMDHKHR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)NCC2=CN(N=C2)C |
Computed by PubChem (NCBI)