CAS 13074-97-0 is the registry number for 1,2-Dibromo-3,4,5,6-tetrachlorobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,2-dibromo-3,4,5,6-tetrachlorobenzene (CAS 13074-97-0) is a chemical compound with the molecular formula C6Br2Cl4 and a molecular weight of 373.7 g/mol. IUPAC name: 1,2-dibromo-3,4,5,6-tetrachlorobenzene. InChIKey: PQOCMOTZTWVPTQ-UHFFFAOYSA-N.
| Molecular formula | C6Br2Cl4 |
|---|---|
| Molecular weight | 373.7 g/mol |
| IUPAC name | 1,2-dibromo-3,4,5,6-tetrachlorobenzene |
| InChIKey | PQOCMOTZTWVPTQ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Cl)Br)Br)Cl)Cl)Cl |
Computed by PubChem (NCBI)