CAS 130745-59-4 is the registry number for 4-((tert-Butyldiphenylsilyl)oxy)cyclohexanone, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[tert-butyl(diphenyl)silyl]oxycyclohexan-1-one (CAS 130745-59-4) is a chemical compound with the molecular formula C22H28O2Si and a molecular weight of 352.5 g/mol. IUPAC name: 4-[tert-butyl(diphenyl)silyl]oxycyclohexan-1-one. InChIKey: QCWGWVNDCMJXAK-UHFFFAOYSA-N.
| Molecular formula | C22H28O2Si |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | 4-[tert-butyl(diphenyl)silyl]oxycyclohexan-1-one |
| InChIKey | QCWGWVNDCMJXAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC3CCC(=O)CC3 |
Computed by PubChem (NCBI)