CAS 130745-77-6 is the registry number for 3,3-Bis(4-chlorobenzyl)-2,4-pentanedione. Offered by: TRC. Available pack sizes: 500mg.
3,3-bis[(4-chlorophenyl)methyl]pentane-2,4-dione (CAS 130745-77-6) is a chemical compound with the molecular formula C19H18Cl2O2 and a molecular weight of 349.2 g/mol. IUPAC name: 3,3-bis[(4-chlorophenyl)methyl]pentane-2,4-dione. InChIKey: BWARYGHRIRQXMS-UHFFFAOYSA-N.
| Molecular formula | C19H18Cl2O2 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 3,3-bis[(4-chlorophenyl)methyl]pentane-2,4-dione |
| InChIKey | BWARYGHRIRQXMS-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CC1=CC=C(C=C1)Cl)(CC2=CC=C(C=C2)Cl)C(=O)C |
Computed by PubChem (NCBI)