CAS 1307584-77-5 is the registry number for N-Propyl L-Isoleucinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S,3S)-2-amino-3-methyl-N-propylpentanamide (CAS 1307584-77-5) is a chemical compound with the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. IUPAC name: (2S,3S)-2-amino-3-methyl-N-propylpentanamide. InChIKey: HTYIIBJDYXOJTP-YUMQZZPRSA-N.
| Molecular formula | C9H20N2O |
|---|---|
| Molecular weight | 172.27 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-methyl-N-propylpentanamide |
| InChIKey | HTYIIBJDYXOJTP-YUMQZZPRSA-N |
| SMILES | CCCNC(=O)[C@H]([C@@H](C)CC)N |
Computed by PubChem (NCBI)