CAS 130798-51-5 appears in our catalog under these names: MDL–29951, MDL 29951, MDL-29951/ 99.49% (existing batch purity), MDL-29951, MDL-29951 98%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 250mg, 25mg, 1mg, 10mg, 50mg, 100mg, 200mg.
3-(2-carboxyethyl)-4,6-dichloro-1H-indole-2-carboxylic acid (CAS 130798-51-5) is a chemical compound with the molecular formula C12H9Cl2NO4 and a molecular weight of 302.11 g/mol. IUPAC name: 3-(2-carboxyethyl)-4,6-dichloro-1H-indole-2-carboxylic acid. InChIKey: KNBSYZNKEAWABY-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO4 |
|---|---|
| Molecular weight | 302.11 g/mol |
| IUPAC name | 3-(2-carboxyethyl)-4,6-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | KNBSYZNKEAWABY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2CCC(=O)O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)