CAS 13080-74-5 appears in our catalog under these names: Carbamazepine Impurity 5, 3,7-Dichloro-10,11-dihydro-5h-dibenzo[b,f]azepine, 95%, 3,7-Dichloro-10,11-dihydro-5H-dibenzo(b,f)azepine, >95% (HPLC), 3,7–Dichloro–10,11–dihydro–5H–dibenzo(b,f)azepine, 3,7-Dichloro-10,11-dihydro-5H-dibenzo[b,f]azepine 97%. Offered by: Chemat Brand, Combi-blocks, TRC, GLPBio, Ambeed. Available pack sizes: on request, 250mg, 1g, 100mg, 10mg, 50mg.
2,9-dichloro-6,11-dihydro-5H-benzo[b][1]benzazepine (CAS 13080-74-5) is a chemical compound with the molecular formula C14H11Cl2N and a molecular weight of 264.1 g/mol. IUPAC name: 2,9-dichloro-6,11-dihydro-5H-benzo[b][1]benzazepine. InChIKey: RRRKOLZRCMHJSN-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2N |
|---|---|
| Molecular weight | 264.1 g/mol |
| IUPAC name | 2,9-dichloro-6,11-dihydro-5H-benzo[b][1]benzazepine |
| InChIKey | RRRKOLZRCMHJSN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Cl)NC3=C1C=CC(=C3)Cl |
Computed by PubChem (NCBI)