CAS 130812-47-4 is the registry number for Barium 1-methoxy-2-propoxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g.
Barium(2+);bis(2-ethoxyethanolate) (CAS 130812-47-4) is a chemical compound with the molecular formula C8H18BaO4 and a molecular weight of 315.55 g/mol. IUPAC name: barium(2+);bis(2-ethoxyethanolate). InChIKey: WCXRGQPXPCQKSJ-UHFFFAOYSA-N.
| Molecular formula | C8H18BaO4 |
|---|---|
| Molecular weight | 315.55 g/mol |
| IUPAC name | barium(2+);bis(2-ethoxyethanolate) |
| InChIKey | WCXRGQPXPCQKSJ-UHFFFAOYSA-N |
| SMILES | CCOCC[O-].CCOCC[O-].[Ba+2] |
Computed by PubChem (NCBI)