CAS 1308236-60-3 is the registry number for 5-((2-Chloro-6-fluorophenyl)methyl)-3-phenyl-1H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(2-chloro-6-fluorophenyl)methyl]-3-phenyl-1H-1,2,4-triazole (CAS 1308236-60-3) is a chemical compound with the molecular formula C15H11ClFN3 and a molecular weight of 287.72 g/mol. IUPAC name: 5-[(2-chloro-6-fluorophenyl)methyl]-3-phenyl-1H-1,2,4-triazole. InChIKey: MEMONQURYKAVOT-UHFFFAOYSA-N.
| Molecular formula | C15H11ClFN3 |
|---|---|
| Molecular weight | 287.72 g/mol |
| IUPAC name | 5-[(2-chloro-6-fluorophenyl)methyl]-3-phenyl-1H-1,2,4-triazole |
| InChIKey | MEMONQURYKAVOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=N2)CC3=C(C=CC=C3Cl)F |
Computed by PubChem (NCBI)