Products 1308272-99-2
CAS 1308272-99-2 is the registry number for Antitubercular agent-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-bromophenyl)-1-(4-methoxyphenyl)tetrazol-5-amine (CAS 1308272-99-2) is a chemical compound with the molecular formula C14H12BrN5O and a molecular weight of 346.18 g/mol. IUPAC name: N-(4-bromophenyl)-1-(4-methoxyphenyl)tetrazol-5-amine. InChIKey: ATCXHWLLJKSCGW-UHFFFAOYSA-N.
| Molecular formula | C14H12BrN5O |
|---|---|
| Molecular weight | 346.18 g/mol |
| IUPAC name | N-(4-bromophenyl)-1-(4-methoxyphenyl)tetrazol-5-amine |
| InChIKey | ATCXHWLLJKSCGW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=NN=N2)NC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
Antitubercular agent-18, orb1688895