CAS 1308279-93-7 is the registry number for (E)-Ethyl 3-(4-bromo-3-chlorophenyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl (E)-3-(4-bromo-3-chlorophenyl)prop-2-enoate (CAS 1308279-93-7) is a chemical compound with the molecular formula C11H10BrClO2 and a molecular weight of 289.55 g/mol. IUPAC name: ethyl (E)-3-(4-bromo-3-chlorophenyl)prop-2-enoate. InChIKey: CPPYEUXVQJKDCY-GQCTYLIASA-N.
| Molecular formula | C11H10BrClO2 |
|---|---|
| Molecular weight | 289.55 g/mol |
| IUPAC name | ethyl (E)-3-(4-bromo-3-chlorophenyl)prop-2-enoate |
| InChIKey | CPPYEUXVQJKDCY-GQCTYLIASA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)