CAS 1308298-23-8 appears in our catalog under these names: (2–(Trifluoromethyl)pyrimidin–5–yl)boronic acid, (2-(Trifluoromethyl)pyrimidin-5-yl)boronic acid, 97%, 97%, (2-(Trifluoromethyl)pyrimidin-5-yl)boronic acid, 95%, (2-(Trifluoromethyl)pyrimidin-5-yl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g, 25g, 100g.
[2-(trifluoromethyl)pyrimidin-5-yl]boronic acid (CAS 1308298-23-8) is a chemical compound with the molecular formula C5H4BF3N2O2 and a molecular weight of 191.91 g/mol. IUPAC name: [2-(trifluoromethyl)pyrimidin-5-yl]boronic acid. InChIKey: OEZMIKKBMMAABO-UHFFFAOYSA-N.
| Molecular formula | C5H4BF3N2O2 |
|---|---|
| Molecular weight | 191.91 g/mol |
| IUPAC name | [2-(trifluoromethyl)pyrimidin-5-yl]boronic acid |
| InChIKey | OEZMIKKBMMAABO-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)