CAS 1308319-48-3 is the registry number for (4S)-4-Amino-1-methyl-l-proline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2S,4S)-4-amino-1-methylpyrrolidine-2-carboxylic acid (CAS 1308319-48-3) is a chemical compound with the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. IUPAC name: (2S,4S)-4-amino-1-methylpyrrolidine-2-carboxylic acid. InChIKey: QAMNOCJJWVAJCX-WHFBIAKZSA-N.
| Molecular formula | C6H12N2O2 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | (2S,4S)-4-amino-1-methylpyrrolidine-2-carboxylic acid |
| InChIKey | QAMNOCJJWVAJCX-WHFBIAKZSA-N |
| SMILES | CN1C[C@H](C[C@H]1C(=O)O)N |
Computed by PubChem (NCBI)