Products 130838-11-8
CAS 130838-11-8 is the registry number for AHR-13268D. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]benzoate (CAS 130838-11-8) is a chemical compound with the molecular formula C28H28F2NNaO4 and a molecular weight of 503.5 g/mol. IUPAC name: sodium 4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]benzoate. InChIKey: MNTCVCOGLDBELB-UHFFFAOYSA-M.
| Molecular formula | C28H28F2NNaO4 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | sodium 4-[3-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]propoxy]benzoate |
| InChIKey | MNTCVCOGLDBELB-UHFFFAOYSA-M |
| SMILES | C1CN(CCC1C(C2=CC=C(C=C2)F)(C3=CC=C(C=C3)F)O)CCCOC4=CC=C(C=C4)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)