Products 130859-46-0
CAS 130859-46-0 is the registry number for 9-Methyl Adenine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
9-(trideuteriomethyl)purin-6-amine (CAS 130859-46-0) is a chemical compound with the molecular formula C6H7N5 and a molecular weight of 152.17 g/mol. IUPAC name: 9-(trideuteriomethyl)purin-6-amine. InChIKey: WRXCXOUDSPTXNX-FIBGUPNXSA-N.
| Molecular formula | C6H7N5 |
|---|---|
| Molecular weight | 152.17 g/mol |
| IUPAC name | 9-(trideuteriomethyl)purin-6-amine |
| InChIKey | WRXCXOUDSPTXNX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C(N=CN=C21)N |
Computed by PubChem (NCBI)