CAS 13092-66-5 appears in our catalog under these names: Magnesium dihydrogen phosphate, Magnesium dihydrogen phosphate 98%, Magnesium dihydrogen phosphate, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 500g, 25g, 100g, 1kg.
Magnesium bis(dihydrogen phosphate) (CAS 13092-66-5) is a chemical compound with the molecular formula H4MgO8P2 and a molecular weight of 218.28 g/mol. IUPAC name: magnesium bis(dihydrogen phosphate). InChIKey: QQFLQYOOQVLGTQ-UHFFFAOYSA-L.
| Molecular formula | H4MgO8P2 |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | magnesium bis(dihydrogen phosphate) |
| InChIKey | QQFLQYOOQVLGTQ-UHFFFAOYSA-L |
| SMILES | OP(=O)(O)[O-].OP(=O)(O)[O-].[Mg+2] |
Computed by PubChem (NCBI)