Products 1309283-09-7
CAS 1309283-09-7 is the registry number for Alendronate-d4 (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-amino-3,3,4,4-tetradeuterio-1-hydroxy-1-phosphonobutyl)phosphonic acid (CAS 1309283-09-7) is a chemical compound with the molecular formula C4H13NO7P2 and a molecular weight of 253.12 g/mol. IUPAC name: (4-amino-3,3,4,4-tetradeuterio-1-hydroxy-1-phosphonobutyl)phosphonic acid. InChIKey: OGSPWJRAVKPPFI-VEPVEJTGSA-N.
| Molecular formula | C4H13NO7P2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | (4-amino-3,3,4,4-tetradeuterio-1-hydroxy-1-phosphonobutyl)phosphonic acid |
| InChIKey | OGSPWJRAVKPPFI-VEPVEJTGSA-N |
| SMILES | [2H]C([2H])(CC(O)(P(=O)(O)O)P(=O)(O)O)C([2H])([2H])N |
Computed by PubChem (NCBI)