Products 1309283-23-5
CAS 1309283-23-5 is the registry number for Orphenadrine-d3 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1 mg.
N-methyl-2-[(2-methylphenyl)-phenylmethoxy]-N-(trideuteriomethyl)ethanamine;hydrochloride (CAS 1309283-23-5) is a chemical compound with the molecular formula C18H24ClNO and a molecular weight of 308.9 g/mol. IUPAC name: N-methyl-2-[(2-methylphenyl)-phenylmethoxy]-N-(trideuteriomethyl)ethanamine;hydrochloride. InChIKey: UQZKYYIKWZOKKD-MUTAZJQDSA-N.
| Molecular formula | C18H24ClNO |
|---|---|
| Molecular weight | 308.9 g/mol |
| IUPAC name | N-methyl-2-[(2-methylphenyl)-phenylmethoxy]-N-(trideuteriomethyl)ethanamine;hydrochloride |
| InChIKey | UQZKYYIKWZOKKD-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2C.Cl |
Computed by PubChem (NCBI)