CAS 130930-47-1 appears in our catalog under these names: rel-(2S,5S)-2-(tert-Butyl)-5-methyl-1,3-dioxolan-4-one, 97%, (2S,5S)-2-TERT-BUTYL-5-METHYL-1,3-DIOXOLAN-4-ONE, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(2S,5S)-2-tert-butyl-5-methyl-1,3-dioxolan-4-one (CAS 130930-47-1) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: (2S,5S)-2-tert-butyl-5-methyl-1,3-dioxolan-4-one. InChIKey: LEWYZEQNYWGOBF-FSPLSTOPSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | (2S,5S)-2-tert-butyl-5-methyl-1,3-dioxolan-4-one |
| InChIKey | LEWYZEQNYWGOBF-FSPLSTOPSA-N |
| SMILES | C[C@H]1C(=O)O[C@H](O1)C(C)(C)C |
Computed by PubChem (NCBI)