CAS 1309379-11-0 is the registry number for 4,6-Dibromo-2-mercaptobenzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4,6-dibromo-3H-1,3-benzothiazole-2-thione (CAS 1309379-11-0) is a chemical compound with the molecular formula C7H3Br2NS2 and a molecular weight of 325.0 g/mol. IUPAC name: 4,6-dibromo-3H-1,3-benzothiazole-2-thione. InChIKey: RIBNBUOCHKVMAZ-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2NS2 |
|---|---|
| Molecular weight | 325.0 g/mol |
| IUPAC name | 4,6-dibromo-3H-1,3-benzothiazole-2-thione |
| InChIKey | RIBNBUOCHKVMAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=S)N2)Br)Br |
Computed by PubChem (NCBI)