Products 1309457-18-8
CAS 1309457-18-8 is the registry number for Spiro Almotriptan. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
1'-methyl-5-(pyrrolidin-1-ylsulfonylmethyl)spiro[1,2-dihydroindole-3,3'-pyrrolidine]-2-ol (CAS 1309457-18-8) is a chemical compound with the molecular formula C17H25N3O3S and a molecular weight of 351.5 g/mol. IUPAC name: 1'-methyl-5-(pyrrolidin-1-ylsulfonylmethyl)spiro[1,2-dihydroindole-3,3'-pyrrolidine]-2-ol. InChIKey: LXSWXVHNXSOIPG-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O3S |
|---|---|
| Molecular weight | 351.5 g/mol |
| IUPAC name | 1'-methyl-5-(pyrrolidin-1-ylsulfonylmethyl)spiro[1,2-dihydroindole-3,3'-pyrrolidine]-2-ol |
| InChIKey | LXSWXVHNXSOIPG-UHFFFAOYSA-N |
| SMILES | CN1CCC2(C1)C(NC3=C2C=C(C=C3)CS(=O)(=O)N4CCCC4)O |
Computed by PubChem (NCBI)