CAS 1309460-27-2 appears in our catalog under these names: Ald-peg4-acid, 95%, Ald–Ph–amido–PEG4–C2–acid, Ald-Ph-amido-PEG4-C2-acid 95%, 1-(4-Formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oic acid, 95%, 95%, Ald-Ph-amido-PEG4-C2-acid, 99.09%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 5g, 100 mg, 250 mg, 1 g, 500 mg.
3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1309460-27-2) is a chemical compound with the molecular formula C19H27NO8 and a molecular weight of 397.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: BRYBRKJZWQVXNZ-UHFFFAOYSA-N.
| Molecular formula | C19H27NO8 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | BRYBRKJZWQVXNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C(=O)NCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)