CAS 1309573-60-1 appears in our catalog under these names: DL-alpha-Tocopherol methoxypolyethylene glycol succinate, 2wt. % in H2O, DL-╬æ-TOCOPHEROL METHOXYPOLYETHYLENE GLY&, DL-ALPHA-TOCOPHEROL METHOXYPOLYETHYLENE&, DL-α-Tocopherol methoxypolyethylene glycol succinate, 97%, 97%, DL-alpha-Tocopherol methoxypolyethylene glycol succinate, 99.0%. Offered by: AmBeed, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 100G, 10G, 25G, 100ML, 10ML, 500ML, 50ML.
1-O-(2-methoxyethyl) 4-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate (CAS 1309573-60-1) is a chemical compound with the molecular formula C36H60O6 and a molecular weight of 588.9 g/mol. IUPAC name: 1-O-(2-methoxyethyl) 4-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate. InChIKey: ZMZHTFWPAUPDMZ-UHFFFAOYSA-N.
| Molecular formula | C36H60O6 |
|---|---|
| Molecular weight | 588.9 g/mol |
| IUPAC name | 1-O-(2-methoxyethyl) 4-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] butanedioate |
| InChIKey | ZMZHTFWPAUPDMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(CC2)(C)CCCC(C)CCCC(C)CCCC(C)C)C)OC(=O)CCC(=O)OCCOC)C |
Computed by PubChem (NCBI)