CAS 1309602-22-9 appears in our catalog under these names: 5-Nitro-4-(2,2,2-trifluoroacetamido)-2-(trifluoromethyl)benzoic acid, 95%, 5-Nitro-4-(2,2,2-trifluoroacetamido)-2-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 25g.
5-nitro-4-[(2,2,2-trifluoroacetyl)amino]-2-(trifluoromethyl)benzoic acid (CAS 1309602-22-9) is a chemical compound with the molecular formula C10H4F6N2O5 and a molecular weight of 346.14 g/mol. IUPAC name: 5-nitro-4-[(2,2,2-trifluoroacetyl)amino]-2-(trifluoromethyl)benzoic acid. InChIKey: HQAMJNRQVPUNEE-UHFFFAOYSA-N.
| Molecular formula | C10H4F6N2O5 |
|---|---|
| Molecular weight | 346.14 g/mol |
| IUPAC name | 5-nitro-4-[(2,2,2-trifluoroacetyl)amino]-2-(trifluoromethyl)benzoic acid |
| InChIKey | HQAMJNRQVPUNEE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])NC(=O)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)