Products 1309602-66-1

CAS 1309602-66-1 is the registry number for 3-Carbethoxy-2,6-bis(difluoromethyl)-4h-pyran-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,6-bis(difluoromethyl)-4-oxopyran-3-carboxylate (CAS 1309602-66-1) is a chemical compound with the molecular formula C10H8F4O4 and a molecular weight of 268.16 g/mol. IUPAC name: ethyl 2,6-bis(difluoromethyl)-4-oxopyran-3-carboxylate. InChIKey: SGIBZSOVJVHQNA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F4O4
Molecular weight268.16 g/mol
IUPAC nameethyl 2,6-bis(difluoromethyl)-4-oxopyran-3-carboxylate
InChIKeySGIBZSOVJVHQNA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(OC(=CC1=O)C(F)F)C(F)F

Computed by PubChem (NCBI)