CAS 1309602-83-2 is the registry number for Potassium 2,2,3,4,4,4-hexafluorobutyrate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 2,2,3,4,4,4-hexafluorobutanoate (CAS 1309602-83-2) is a chemical compound with the molecular formula C4HF6KO2 and a molecular weight of 234.14 g/mol. IUPAC name: potassium 2,2,3,4,4,4-hexafluorobutanoate. InChIKey: ZJBJGNDGFLCRAT-UHFFFAOYSA-M.
| Molecular formula | C4HF6KO2 |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | potassium 2,2,3,4,4,4-hexafluorobutanoate |
| InChIKey | ZJBJGNDGFLCRAT-UHFFFAOYSA-M |
| SMILES | C(C(C(=O)[O-])(F)F)(C(F)(F)F)F.[K+] |
Computed by PubChem (NCBI)