CAS 1309606-36-7 is the registry number for 2-Bromo-6-fluorobenzaldehyde oxime, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
(NE)-N-[(2-bromo-6-fluorophenyl)methylidene]hydroxylamine (CAS 1309606-36-7) is a chemical compound with the molecular formula C7H5BrFNO and a molecular weight of 218.02 g/mol. IUPAC name: (NE)-N-[(2-bromo-6-fluorophenyl)methylidene]hydroxylamine. InChIKey: YJPYUCCJWGUXAA-ONNFQVAWSA-N.
| Molecular formula | C7H5BrFNO |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | (NE)-N-[(2-bromo-6-fluorophenyl)methylidene]hydroxylamine |
| InChIKey | YJPYUCCJWGUXAA-ONNFQVAWSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)/C=N/O)F |
Computed by PubChem (NCBI)