Products 1309665-26-6

CAS 1309665-26-6 is the registry number for Methyl 2-(4-(4-Chlorobut-1-yn-1-yl)phenyl)-2-methylpropanoate. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.

Structural formula: {0} (CAS {1})

Methyl 2-[4-(4-chlorobut-1-ynyl)phenyl]-2-methylpropanoate (CAS 1309665-26-6) is a chemical compound with the molecular formula C15H17ClO2 and a molecular weight of 264.74 g/mol. IUPAC name: methyl 2-[4-(4-chlorobut-1-ynyl)phenyl]-2-methylpropanoate. InChIKey: XBLMDSZBNUQWAI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17ClO2
Molecular weight264.74 g/mol
IUPAC namemethyl 2-[4-(4-chlorobut-1-ynyl)phenyl]-2-methylpropanoate
InChIKeyXBLMDSZBNUQWAI-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=C(C=C1)C#CCCCl)C(=O)OC

Computed by PubChem (NCBI)