Products 130992-20-0

CAS 130992-20-0 is the registry number for Oxo(1,3,4-thiadiazol-2-ylamino)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-oxo-2-(1,3,4-thiadiazol-2-ylamino)acetic acid (CAS 130992-20-0) is a chemical compound with the molecular formula C4H3N3O3S and a molecular weight of 173.15 g/mol. IUPAC name: 2-oxo-2-(1,3,4-thiadiazol-2-ylamino)acetic acid. InChIKey: BKRSPAQARUBDQM-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3N3O3S
Molecular weight173.15 g/mol
IUPAC name2-oxo-2-(1,3,4-thiadiazol-2-ylamino)acetic acid
InChIKeyBKRSPAQARUBDQM-UHFFFAOYSA-N
SMILESC1=NN=C(S1)NC(=O)C(=O)O

Computed by PubChem (NCBI)