Products 1309928-44-6
CAS 1309928-44-6 is the registry number for Bensulfuron-methyl-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 1 mg.
Methyl 2-[[4,6-bis(trideuteriomethoxy)pyrimidin-2-yl]carbamoylsulfamoylmethyl]benzoate (CAS 1309928-44-6) is a chemical compound with the molecular formula C16H18N4O7S and a molecular weight of 416.4 g/mol. IUPAC name: methyl 2-[[4,6-bis(trideuteriomethoxy)pyrimidin-2-yl]carbamoylsulfamoylmethyl]benzoate. InChIKey: XMQFTWRPUQYINF-WFGJKAKNSA-N.
| Molecular formula | C16H18N4O7S |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | methyl 2-[[4,6-bis(trideuteriomethoxy)pyrimidin-2-yl]carbamoylsulfamoylmethyl]benzoate |
| InChIKey | XMQFTWRPUQYINF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)CC2=CC=CC=C2C(=O)OC)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)