CAS 1309976-62-2 appears in our catalog under these names: VU 0360172, VU 0360172 hydrochloride, VU 0360172 hydrochloride, VU 0360172-d6, N-cyclobutyl-6-((3-fluorophenyl)ethynyl)nicotinamide hydrochloride, ≥98%(HPLC), ≥98%(HPLC). Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 100 mg, 25 mg, 50 mg.
N-cyclobutyl-6-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide;hydrochloride (CAS 1309976-62-2) is a chemical compound with the molecular formula C18H16ClFN2O and a molecular weight of 330.8 g/mol. IUPAC name: N-cyclobutyl-6-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide;hydrochloride. InChIKey: NBGAPTWZQXSEAA-UHFFFAOYSA-N.
| Molecular formula | C18H16ClFN2O |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | N-cyclobutyl-6-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide;hydrochloride |
| InChIKey | NBGAPTWZQXSEAA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)NC(=O)C2=CN=C(C=C2)C#CC3=CC(=CC=C3)F.Cl |
Computed by PubChem (NCBI)