CAS 1309980-79-7 appears in our catalog under these names: (5-Bromo-2-[(2,2-dimethylpropoxy)carbonyl]phenyl)boronic acid, 95%, (5-Bromo-2-((neopentyloxy)carbonyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[5-bromo-2-(2,2-dimethylpropoxycarbonyl)phenyl]boronic acid (CAS 1309980-79-7) is a chemical compound with the molecular formula C12H16BBrO4 and a molecular weight of 314.97 g/mol. IUPAC name: [5-bromo-2-(2,2-dimethylpropoxycarbonyl)phenyl]boronic acid. InChIKey: PFQQZEMAZQNSCZ-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO4 |
|---|---|
| Molecular weight | 314.97 g/mol |
| IUPAC name | [5-bromo-2-(2,2-dimethylpropoxycarbonyl)phenyl]boronic acid |
| InChIKey | PFQQZEMAZQNSCZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)C(=O)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)