CAS 131-52-2 appears in our catalog under these names: Pentachlorophenol Sodium Salt, >95% (HPLC), Pentachlorophenol sodium. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10g, 1g, 2,5g, 250mg, 0,5kg, 1kg, 2kg.
Sodium 2,3,4,5,6-pentachlorophenolate (CAS 131-52-2) is a chemical compound with the molecular formula C6Cl5NaO and a molecular weight of 288.3 g/mol. IUPAC name: sodium 2,3,4,5,6-pentachlorophenolate. InChIKey: HCJLVWUMMKIQIM-UHFFFAOYSA-M.
| Molecular formula | C6Cl5NaO |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | sodium 2,3,4,5,6-pentachlorophenolate |
| InChIKey | HCJLVWUMMKIQIM-UHFFFAOYSA-M |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[O-].[Na+] |
Computed by PubChem (NCBI)