CAS 1310278-53-5 appears in our catalog under these names: tert-Butyl 3-aminopyrrolidine-1-carboxylate 2-hydroxypropane-1,2,3-tricarboxylate, 95%, tert-Butyl 3-aminopyrrolidine-1-carboxylate 2-hydroxypropane-1,2,3-tricarboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g.
Tert-butyl 3-aminopyrrolidine-1-carboxylate;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 1310278-53-5) is a chemical compound with the molecular formula C15H26N2O9 and a molecular weight of 378.37 g/mol. IUPAC name: tert-butyl 3-aminopyrrolidine-1-carboxylate;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: CFUMDLIQNLTSLJ-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O9 |
|---|---|
| Molecular weight | 378.37 g/mol |
| IUPAC name | tert-butyl 3-aminopyrrolidine-1-carboxylate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | CFUMDLIQNLTSLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)N.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)