CAS 1310403-77-0 appears in our catalog under these names: (4-Fluorophenylaminomethyl)-4-benzeneboronic acid, 95%, (4-(((4-Fluorophenyl)amino)methyl)phenyl)boronic acid, 98%, 4–(4–Aminophenyl) fluoromethyl boronic acid, (4-(((4-fluorophenyl)amino)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 5g, 1g.
[4-[(4-fluoroanilino)methyl]phenyl]boronic acid (CAS 1310403-77-0) is a chemical compound with the molecular formula C13H13BFNO2 and a molecular weight of 245.06 g/mol. IUPAC name: [4-[(4-fluoroanilino)methyl]phenyl]boronic acid. InChIKey: CSNVMFZDDMXQIV-UHFFFAOYSA-N.
| Molecular formula | C13H13BFNO2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | [4-[(4-fluoroanilino)methyl]phenyl]boronic acid |
| InChIKey | CSNVMFZDDMXQIV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)