CAS 1310416-60-4 appears in our catalog under these names: 5-Bromo-2-fluoro-n,n-dimethylnicotinamide, 95%, 5-Bromo-2-fluoro-N,N-dimethylnicotinamide, ≥95%, ≥95%, 5-Bromo-2-fluoro-N,N-dimethylnicotinamide, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
5-bromo-2-fluoro-N,N-dimethylpyridine-3-carboxamide (CAS 1310416-60-4) is a chemical compound with the molecular formula C8H8BrFN2O and a molecular weight of 247.06 g/mol. IUPAC name: 5-bromo-2-fluoro-N,N-dimethylpyridine-3-carboxamide. InChIKey: GVCREZJBWVGSHY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrFN2O |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 5-bromo-2-fluoro-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | GVCREZJBWVGSHY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(N=CC(=C1)Br)F |
Computed by PubChem (NCBI)