CAS 13106-24-6 appears in our catalog under these names: N,N-Dibutyl-N-methylbutan-1-aminium methyl sulfate, 98%, Tributylmethylammonium methyl sulfate, Tributylmethylammonium methyl sulfate, Tributylmethylammonium methyl sulfate, 95%, 95%. Offered by: AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 50g, 100g, 250g.
Methyl sulfate;tributyl(methyl)azanium (CAS 13106-24-6) is a chemical compound with the molecular formula C14H33NO4S and a molecular weight of 311.48 g/mol. IUPAC name: methyl sulfate;tributyl(methyl)azanium. InChIKey: FIMHASWLGDDANN-UHFFFAOYSA-M.
| Molecular formula | C14H33NO4S |
|---|---|
| Molecular weight | 311.48 g/mol |
| IUPAC name | methyl sulfate;tributyl(methyl)azanium |
| InChIKey | FIMHASWLGDDANN-UHFFFAOYSA-M |
| SMILES | CCCC[N+](C)(CCCC)CCCC.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)