CAS 1310684-78-6 appears in our catalog under these names: 1,1'-(1,3-Phenylene)bis(4,4,4-trifluorobutane-1,3-dione), 95%, 1,1'-(1,3-Phenylene)bis(4,4,4-trifluorobutane-1,3-dione), 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
4,4,4-trifluoro-1-[3-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]butane-1,3-dione (CAS 1310684-78-6) is a chemical compound with the molecular formula C14H8F6O4 and a molecular weight of 354.20 g/mol. IUPAC name: 4,4,4-trifluoro-1-[3-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]butane-1,3-dione. InChIKey: KKEBCCKBRYDGTB-UHFFFAOYSA-N.
| Molecular formula | C14H8F6O4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-[3-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]butane-1,3-dione |
| InChIKey | KKEBCCKBRYDGTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)CC(=O)C(F)(F)F)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)