CAS 1310686-07-7 appears in our catalog under these names: 4-tert-Butyl-2-(1-methyl-2-nitroethyl) Cyclohexanone, 4-t-Butyl-2-(1-methyl-2-nitroethyl)cyclohexanone (Mixture of Diastereomers). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-tert-butyl-2-(1-nitropropan-2-yl)cyclohexan-1-one (CAS 1310686-07-7) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: 4-tert-butyl-2-(1-nitropropan-2-yl)cyclohexan-1-one. InChIKey: ANHQMMGUJDQQGA-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | 4-tert-butyl-2-(1-nitropropan-2-yl)cyclohexan-1-one |
| InChIKey | ANHQMMGUJDQQGA-UHFFFAOYSA-N |
| SMILES | CC(C[N+](=O)[O-])C1CC(CCC1=O)C(C)(C)C |
Computed by PubChem (NCBI)