CAS 1310697-89-2 is the registry number for 3-Bromo-5-fluorophenoxy(tert-butyl)dimethylsilane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
(3-bromo-5-fluorophenoxy)-tert-butyl-dimethylsilane (CAS 1310697-89-2) is a chemical compound with the molecular formula C12H18BrFOSi and a molecular weight of 305.26 g/mol. IUPAC name: (3-bromo-5-fluorophenoxy)-tert-butyl-dimethylsilane. InChIKey: CJBQHUDSGJQEJD-UHFFFAOYSA-N.
| Molecular formula | C12H18BrFOSi |
|---|---|
| Molecular weight | 305.26 g/mol |
| IUPAC name | (3-bromo-5-fluorophenoxy)-tert-butyl-dimethylsilane |
| InChIKey | CJBQHUDSGJQEJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)