Products 1310729-92-0

CAS 1310729-92-0 is the registry number for S-(3,3-Difluorocyclobutyl)ethanethioic acid ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

S-(3,3-difluorocyclobutyl) ethanethioate (CAS 1310729-92-0) is a chemical compound with the molecular formula C6H8F2OS and a molecular weight of 166.19 g/mol. IUPAC name: S-(3,3-difluorocyclobutyl) ethanethioate. InChIKey: SQZSUTSMLZXHSG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8F2OS
Molecular weight166.19 g/mol
IUPAC nameS-(3,3-difluorocyclobutyl) ethanethioate
InChIKeySQZSUTSMLZXHSG-UHFFFAOYSA-N
SMILESCC(=O)SC1CC(C1)(F)F

Computed by PubChem (NCBI)