CAS 1310796-19-0 is the registry number for (Z)-tert-Butyl 3-((dimethylamino)methylene)-4-oxopiperidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 25g.
Tert-butyl (3Z)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate (CAS 1310796-19-0) is a chemical compound with the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. IUPAC name: tert-butyl (3Z)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate. InChIKey: YUSMZDVTEOAHDL-NTMALXAHSA-N.
| Molecular formula | C13H22N2O3 |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | tert-butyl (3Z)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate |
| InChIKey | YUSMZDVTEOAHDL-NTMALXAHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)/C(=C\N(C)C)/C1 |
Computed by PubChem (NCBI)