CAS 1310877-37-2 is the registry number for (R)-N-(1-(4-Bromothiophen-2-yl)ethylidene)-2-methylpropane-2-sulfinamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(R)-N-[1-(4-bromothiophen-2-yl)ethylidene]-2-methylpropane-2-sulfinamide (CAS 1310877-37-2) is a chemical compound with the molecular formula C10H14BrNOS2 and a molecular weight of 308.3 g/mol. IUPAC name: (R)-N-[1-(4-bromothiophen-2-yl)ethylidene]-2-methylpropane-2-sulfinamide. InChIKey: WTQPLQZJNABROQ-OAHLLOKOSA-N.
| Molecular formula | C10H14BrNOS2 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | (R)-N-[1-(4-bromothiophen-2-yl)ethylidene]-2-methylpropane-2-sulfinamide |
| InChIKey | WTQPLQZJNABROQ-OAHLLOKOSA-N |
| SMILES | CC(=N[S@](=O)C(C)(C)C)C1=CC(=CS1)Br |
Computed by PubChem (NCBI)